Information card for entry 2010835
| Chemical name |
N,N'-bis-(2-tosylaminobenzylidene)benzene-1,2-diamine |
| Formula |
C34 H30 N4 O4 S2 |
| Calculated formula |
C34 H30 N4 O4 S2 |
| SMILES |
S(=O)(=O)(Nc1ccccc1/C=N/c1ccccc1/N=C/c1ccccc1NS(=O)(=O)c1ccc(cc1)C)c1ccc(C)cc1 |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(2-tosylaminobenzylidene)benzene-1,2-diamine |
| Authors of publication |
Mahía, José; Maestro, Miguel A.; Vázquez, Miguel; Bermejo, Manuel R.; González, Ana M.; Maneiro, Marcelino |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
4 |
| Pages of publication |
492 - 493 |
| a |
9.704 ± 0.002 Å |
| b |
19.102 ± 0.004 Å |
| c |
17.407 ± 0.004 Å |
| α |
90° |
| β |
103.85 ± 0.02° |
| γ |
90° |
| Cell volume |
3132.8 ± 1.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.104 |
| Residual factor for significantly intense reflections |
0.057 |
| Weighted residual factors for all reflections included in the refinement |
0.143 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010835.html