Information card for entry 2010962
| Formula |
C26 H34 O6 |
| Calculated formula |
C26 H34 O6 |
| SMILES |
O[C@H]1[C@H]([C@H](OCc2ccc(OC)cc2)[C@@H](OCc2ccc(OC)cc2)CC1)[C@]1(O[C@@H]1C)C |
| Title of publication |
(1<i>R</i>,2<i>R</i>,3<i>S</i>,4<i>S</i>)-2-[(2<i>R</i>,3<i>S</i>)-2,3-Dimethyloxiran-2-yl]-3,4-bis(4-methoxybenzyloxy)cyclohexanol |
| Authors of publication |
Kani, Yoshiyuki; Ohba, Shigeru; Amano, Seiji; Ogawa, Noriko; Ohtsuka, Masami; Chida, Noritaka |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
5 |
| Pages of publication |
e222 - e222 |
| a |
18.06 ± 0.003 Å |
| b |
23.477 ± 0.003 Å |
| c |
5.736 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2432 ± 1 Å3 |
| Cell temperature |
296 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for significantly intense reflections |
0.073 |
| Weighted residual factors for all reflections included in the refinement |
0.221 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.92 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010962.html