Information card for entry 2011089
| Chemical name |
Aqua(5,6-dimethyl-1,10-phenanthroline)(glycolato)copper(II) nitrate |
| Formula |
C16 H17 Cu N3 O7 |
| Calculated formula |
C16 H17 Cu N3 O7 |
| SMILES |
[Cu]15([OH2])([n]2cccc3c(c(c4ccc[n]1c4c23)C)C)OC(=O)C[OH]5.N(=O)(=O)[O-] |
| Title of publication |
Aqua(5,6-dimethyl-1,10-phenanthroline-<i>N</i>,<i>N</i>')(glycolato-<i>O</i>,<i>O</i>')copper(II) nitrate |
| Authors of publication |
Medina, Gerardo; Gasque, Laura; Bernès, Sylvain |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
7 |
| Pages of publication |
766 - 768 |
| a |
7.0373 ± 0.0007 Å |
| b |
10.0928 ± 0.0011 Å |
| c |
13.1649 ± 0.0013 Å |
| α |
103.225 ± 0.008° |
| β |
105.45 ± 0.012° |
| γ |
103.76 ± 0.009° |
| Cell volume |
831.68 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0429 |
| Residual factor for significantly intense reflections |
0.0339 |
| Weighted residual factors for all reflections included in the refinement |
0.0919 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011089.html