Information card for entry 2011113
| Formula |
C16 H25 Cl4 N O Te |
| Calculated formula |
C16 H25 Cl4 N O Te |
| SMILES |
[Te]1(Cl)(Cl)(Cl)OCC(=C1)Cl.[N+](Cc1ccccc1)(CC)(CC)CC |
| Title of publication |
Benzyltriethylammonium 2,2,2,4-tetrachloro-2,5-dihydro-1,2λ^5^-oxatellurole |
| Authors of publication |
Zukerman-Schpector, J.; Camillo, Robinson L.; Comasseto, João V.; Cunha, Rodrigo L. O. R.; Caracelli, I. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
7 |
| Pages of publication |
897 - 898 |
| a |
7.5837 ± 0.0004 Å |
| b |
11.2598 ± 0.0005 Å |
| c |
12.8491 ± 0.0007 Å |
| α |
94.403 ± 0.004° |
| β |
103.025 ± 0.004° |
| γ |
98.284 ± 0.004° |
| Cell volume |
1051 ± 0.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.025 |
| Residual factor for significantly intense reflections |
0.022 |
| Weighted residual factors for all reflections included in the refinement |
0.059 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011113.html