Information card for entry 2011170
| Chemical name |
Dicyclohexylammonium) 2,4-dichlorophenoxyacetate |
| Formula |
C20 H29 Cl2 N O3 |
| Calculated formula |
C20 H29 Cl2 N O3 |
| SMILES |
Clc1c(OCC(=O)[O-])ccc(Cl)c1.[NH2+](C1CCCCC1)C1CCCCC1 |
| Title of publication |
Dicyclohexylammonium 2,4-dichlorophenoxyacetate and (2,4-dichlorophenoxyacetato-<i>O</i>,<i>O</i>')bis(triphenylphosphine-<i>P</i>)silver(I) |
| Authors of publication |
Subramanian, Ramis Rao; Anandan, Shanmuga S.; Kwek, Kuan Hiang; Low, Kum Sang; Shanmuga Sundara Raj, S.; Fun, Hoong-Kun; Razak, Ibrahim Abdul; Hanna, John V.; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
7 |
| Pages of publication |
e292 - e294 |
| a |
13.3847 ± 0.0001 Å |
| b |
18.2966 ± 0.0003 Å |
| c |
8.978 ± 0.0001 Å |
| α |
90° |
| β |
105.296 ± 0.001° |
| γ |
90° |
| Cell volume |
2120.78 ± 0.05 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.09 |
| Residual factor for significantly intense reflections |
0.063 |
| Weighted residual factors for all reflections included in the refinement |
0.198 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011170.html