Information card for entry 2011484
| Formula |
C51 H59 N O11 S |
| Calculated formula |
C51 H59 N O11 S |
| SMILES |
S(=O)(=O)(N1CCOCCOc2c3Cc4c5OCCOCCOCCOCCOc6c(Cc7c(OCCOCC1)c(ccc7)Cc5ccc4)cccc6Cc2ccc3)c1ccc(cc1)C |
| Title of publication |
25,27-(6-Tosyl-3,9-dioxa-6-azaundecane-1,11-diyldioxy)-26,28-(3,6,9-trioxaundecane-1,11-diyldioxy)calix[4]arene |
| Authors of publication |
Kim, Jong Seung; Lee, Won Ku; Rim, Jeong Ah; Jensen, William P.; Lee, Jin-Ho; Kim, Moon-Jib; Kim, Jin-Gyu; Suh, Il-Hwan |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
11 |
| Pages of publication |
1369 - 1371 |
| a |
23.547 ± 0.002 Å |
| b |
10.922 ± 0.003 Å |
| c |
19.4876 ± 0.0018 Å |
| α |
90° |
| β |
113.34 ± 0.007° |
| γ |
90° |
| Cell volume |
4601.7 ± 1.4 Å3 |
| Cell temperature |
289 ± 2 K |
| Ambient diffraction temperature |
289 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.2033 |
| Residual factor for significantly intense reflections |
0.0808 |
| Weighted residual factors for all reflections included in the refinement |
0.2063 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011484.html