Information card for entry 2011869
| Common name |
Compound 1 |
| Chemical name |
2,7–dihydro–2,2,7,7–tetramethyl–3,6–diphenyl–1,4,5–thiadiazepine |
| Formula |
C20 H22 N2 S |
| Calculated formula |
C20 H22 N2 S |
| SMILES |
CC1(C)SC(C)(C)C(=NN=C1c1ccccc1)c1ccccc1 |
| Title of publication |
A comparison of 2,7-dihydro-2,2,7,7-tetramethyl-3,6-diphenyl-1,4,5-thiadiazepine and the corresponding 1,1-dioxide |
| Authors of publication |
Cuthbertson, Eric; Frampton, Christopher S.; MacNicol, David D. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
4 |
| Pages of publication |
431 - 432 |
| a |
19.4661 ± 0.0007 Å |
| b |
10.7312 ± 0.0004 Å |
| c |
8.3 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1733.83 ± 0.11 Å3 |
| Cell temperature |
123 ± 1 K |
| Ambient diffraction temperature |
123 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0386 |
| Residual factor for significantly intense reflections |
0.0335 |
| Weighted residual factors for all reflections included in the refinement |
0.1219 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011869.html