Information card for entry 2011958
| Chemical name |
9,10-dimethoxy-11-oxatricyclo[6.2.1.0^2,7^]undeca-4,9-diene-3,6-diol |
| Formula |
C12 H16 O5 |
| Calculated formula |
C12 H16 O5 |
| SMILES |
O1[C@H]2[C@@H]3[C@H](O)C=C[C@H](O)[C@@H]3[C@@H]1C(=C2OC)OC |
| Title of publication |
Two polycyclic compounds derived from a Diels–Alder reaction |
| Authors of publication |
Zukerman-Schpector, J.; Caracelli, I.; Vega, Mauricio; Constantino, Mauricio Gomes; Beatriz, Adilson; da Silva, Gil Valdo |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
5 |
| Pages of publication |
646 - 648 |
| a |
8.0796 ± 0.0004 Å |
| b |
10.197 ± 0.0007 Å |
| c |
13.7534 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1133.11 ± 0.12 Å3 |
| Cell temperature |
293 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.034 |
| Residual factor for significantly intense reflections |
0.028 |
| Weighted residual factors for all reflections |
0.073 |
| Weighted residual factors for all reflections included in the refinement |
0.071 |
| Goodness-of-fit parameter for all reflections |
1.054 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011958.html