Information card for entry 2012018
| Chemical name |
4,7-bis[(4-pyridyl)ethynyl]-2,1,3-benzothiadiazole |
| Formula |
C20 H10 N4 S |
| Calculated formula |
C20 H10 N4 S |
| SMILES |
s1nc2c(ccc(c2n1)C#Cc1ccncc1)C#Cc1ccncc1 |
| Title of publication |
4,7-Bis(4-pyridylethynyl)-2,1,3-benzothiadiazole and its dipyridinium diperchlorate |
| Authors of publication |
Akhtaruzzaman, Md.; Tomura, Masaaki; Yamashita, Yoshiro |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
6 |
| Pages of publication |
751 - 753 |
| a |
12.487 ± 0.002 Å |
| b |
7.5477 ± 0.0013 Å |
| c |
17.513 ± 0.003 Å |
| α |
90° |
| β |
105.22 ± 0.02° |
| γ |
90° |
| Cell volume |
1592.7 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.1282 |
| Residual factor for significantly intense reflections |
0.0682 |
| Weighted residual factors for all reflections included in the refinement |
0.2092 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012018.html