Information card for entry 2012132
| Chemical name |
[3-Co{η^5^-(2,5-(CH~3~)~2~-NC~4~H~2~)}-1-CH~3~-1,2-C~2~B~9~H~10~] |
| Formula |
C9 H21 B9 Co N |
| Calculated formula |
C9 H21 B9 Co N |
| SMILES |
[Co]12345678([n]9c5([cH]4[cH]3[c]29C)C)[C]234([CH]591[BH]1%104[BH]4%113[BH]362[BH]268[BH]875[BH]59%10[BH]71%11[BH]432[BH]6857)C |
| Title of publication |
η^5^-(3)-1-Methyl-1,2-dicarbollyl-η^5^-2',5'-dimethylpyrrolylcobalt(III) |
| Authors of publication |
Sillanpää, Reijo; Llop, Jordi; Viñas, Clara; Teixidor, Frances; Kivekäs, Raikko |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
8 |
| Pages of publication |
900 - 901 |
| a |
8.163 ± 0.0011 Å |
| b |
16.3957 ± 0.001 Å |
| c |
11.5686 ± 0.0014 Å |
| α |
90° |
| β |
98.622 ± 0.011° |
| γ |
90° |
| Cell volume |
1530.8 ± 0.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0474 |
| Residual factor for significantly intense reflections |
0.0302 |
| Weighted residual factors for all reflections included in the refinement |
0.0767 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012132.html