Information card for entry 2012334
| Chemical name |
Chloro(isoquinoline-1-carboxylato-O,N)(2,9-dimethyl-1,10-phenanthroline- N,N')copper(II) |
| Formula |
C24 H18 Cl Cu N3 O2 |
| Calculated formula |
C24 H18 Cl Cu N3 O2 |
| SMILES |
[Cu]12(Cl)(OC(=O)c3[n]1ccc1c3cccc1)[n]1c(ccc3ccc4ccc([n]2c4c13)C)C |
| Title of publication |
Chloro(2,9-dimethyl-1,10-phenanthroline-<i>N</i>,<i>N</i>')(isoquinoline-1-carboxylato-<i>O</i>,<i>N</i>)copper(II) |
| Authors of publication |
Lemoine, Pascale; Viossat, Bernard |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
11 |
| Pages of publication |
1248 - 1250 |
| a |
11.855 ± 0.001 Å |
| b |
15.955 ± 0.001 Å |
| c |
22.391 ± 0.001 Å |
| α |
90° |
| β |
103.77 ± 0.01° |
| γ |
90° |
| Cell volume |
4113.5 ± 0.5 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.065 |
| Residual factor for significantly intense reflections |
0.041 |
| Weighted residual factors for all reflections included in the refinement |
0.118 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012334.html