Information card for entry 2012351
| Chemical name |
N^1^,N^1^-Diethyl-N^2^-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)acetamidine |
| Formula |
C20 H32 N2 O9 |
| Calculated formula |
C20 H32 N2 O9 |
| SMILES |
O1[C@@H](\N=C(\N(CC)CC)C)[C@H](OC(=O)C)[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H]1COC(=O)C |
| Title of publication |
<i>N</i>^1^,<i>N</i>^1^-Diethyl-<i>N</i>^2^-(2,3,4,6-tetra-<i>O</i>-acetyl-β-<small>D</small>-glucopyranosyl)acetamidine |
| Authors of publication |
Diánez, María Jesús; Estrada, María Dolores; López-Castro, Amparo; Pérez-Garrido, Simeón |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
11 |
| Pages of publication |
1297 - 1298 |
| a |
10.44 ± 0.002 Å |
| b |
27.647 ± 0.005 Å |
| c |
8.012 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2312.5 ± 0.8 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.103 |
| Residual factor for significantly intense reflections |
0.069 |
| Weighted residual factors for significantly intense reflections |
0.182 |
| Goodness-of-fit parameter for all reflections |
1.118 |
| Goodness-of-fit parameter for significantly intense reflections |
1.099 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012351.html