Information card for entry 2012378
| Chemical name |
2,3,5,6,7,8-Hexahydro-3-(2-hydroxy-1-methylpropyl)-6,8-methano-7,7,8a- trimethyl-5H-1,4-benzoxazin-2-one |
| Formula |
C16 H25 N O3 |
| Calculated formula |
C16 H25 N O3 |
| SMILES |
O[C@@H]([C@@H]([C@H]1N=C2[C@](OC1=O)([C@@H]1C[C@H](C2)C1(C)C)C)C)C |
| Title of publication |
Full stereochemical understanding in a new (2<i>R</i>,3<i>R</i>,4<i>R</i>)-4-hydroxyisoleucine synthesis |
| Authors of publication |
Rolland, Marc; Kassem, Tarek; Rolland, Valérie; Martinez, Jean |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
12 |
| Pages of publication |
1415 - 1417 |
| a |
10.2905 ± 0.0003 Å |
| b |
11.8864 ± 0.0005 Å |
| c |
12.8317 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1569.54 ± 0.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.041 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.098 |
| Weighted residual factors for all reflections included in the refinement |
0.1 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012378.html