Information card for entry 2012464
| Chemical name |
1,1,4,4-tetramethylpiperazinium pentabromothallate(III) |
| Formula |
C8 H20 Br5 N2 Tl |
| Calculated formula |
C8 H20 Br5 N2 Tl |
| SMILES |
C1[N+](CC[N+](C1)(C)C)(C)C.[Tl]([Br-])([Br-])(Br)(Br)Br |
| Title of publication |
A second polymorph of 1,1,4,4-tetramethylpiperazinium pentabromothallate(III) |
| Authors of publication |
Linden, Anthony; Petridis, Alexander; James, Bruce D. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
1 |
| Pages of publication |
m53 - m55 |
| a |
16.0822 ± 0.0003 Å |
| b |
9.2422 ± 0.0002 Å |
| c |
13.2718 ± 0.0002 Å |
| α |
90° |
| β |
114.393 ± 0.0008° |
| γ |
90° |
| Cell volume |
1796.57 ± 0.06 Å3 |
| Cell temperature |
173 ± 1 K |
| Ambient diffraction temperature |
173 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0349 |
| Residual factor for significantly intense reflections |
0.0292 |
| Weighted residual factors for significantly intense reflections |
0.066 |
| Weighted residual factors for all reflections included in the refinement |
0.0678 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012464.html