Information card for entry 2012466
| Common name |
Macrocalyxin I |
| Chemical name |
2-[1,2,3,4,4a,4b,5,6,7,8,8a,9-dodecahydro-7-hydroxy-4b,8,8-trimethylphenanthren- 2-yl]propenoic acid |
| Formula |
C20 H30 O3 |
| Calculated formula |
C20 H30 O3 |
| SMILES |
O[C@@H]1CC[C@]2([C@H](C1(C)C)CC=C1[C@@H]2CC[C@@H](C1)C(=C)C(=O)O)C |
| Title of publication |
Macrocalyxin I |
| Authors of publication |
Shi, Hao; Pan, Yuan Jiang |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
1 |
| Pages of publication |
o55 - o56 |
| a |
24.066 ± 0.002 Å |
| b |
10.017 ± 0.001 Å |
| c |
7.608 ± 0.001 Å |
| α |
90° |
| β |
101.35 ± 0.01° |
| γ |
90° |
| Cell volume |
1798.2 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0576 |
| Residual factor for significantly intense reflections |
0.04 |
| Weighted residual factors for significantly intense reflections |
0.0907 |
| Weighted residual factors for all reflections included in the refinement |
0.0968 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.98 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012466.html