Information card for entry 2012582
| Chemical name |
aquochloro(1,10-phenanthroline-N,N')(4-methylphenylsulfonate-O)copper(II) |
| Formula |
C19 H17 Cl Cu N2 O4 S |
| Calculated formula |
C19 H17 Cl Cu N2 O4 S |
| SMILES |
[Cu]1([OH2])(Cl)(OS(=O)(=O)c2ccc(cc2)C)[n]2cccc3c2c2[n]1cccc2cc3 |
| Title of publication |
Aquachloro(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')(<i>p</i>-toluenesulfonato-κ<i>O</i>)copper(II) |
| Authors of publication |
Aller, Cristina; Castro, Jesús; Pérez-Lourido, Paulo; Labisbal, Elena; García-Vázquez, José Arturo |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
3 |
| Pages of publication |
m155 - m157 |
| a |
7.0887 ± 0.0007 Å |
| b |
9.9723 ± 0.0009 Å |
| c |
14.417 ± 0.0013 Å |
| α |
83.773 ± 0.002° |
| β |
78.629 ± 0.002° |
| γ |
77.153 ± 0.002° |
| Cell volume |
971.9 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0509 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for significantly intense reflections |
0.1227 |
| Weighted residual factors for all reflections included in the refinement |
0.1259 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012582.html