Information card for entry 2012699
| Chemical name |
3-methyl-1,4-diphenyl-1H-pyrazolo-(3,4-b)pyridine |
| Formula |
C19 H15 N3 |
| Calculated formula |
C19 H15 N3 |
| SMILES |
n1(c2ccccc2)nc(c2c(c3ccccc3)ccnc12)C |
| Title of publication |
C—H···π and π–π interactions in the supramolecular structure of 3-methyl-1,4-diphenyl-1<i>H</i>-pyrazolo[3,4-<i>b</i>]pyridine |
| Authors of publication |
Low, John N.; Cobo, Justo; Nogueras, Manuel; Sánchez, Adolfo; Torres, Harlen; Insuasty, Braulio |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
5 |
| Pages of publication |
o298 - o300 |
| a |
8.1392 ± 0.0004 Å |
| b |
8.4351 ± 0.0004 Å |
| c |
11.3852 ± 0.0006 Å |
| α |
77.951 ± 0.003° |
| β |
81.192 ± 0.002° |
| γ |
70.681 ± 0.002° |
| Cell volume |
718.39 ± 0.06 Å3 |
| Cell temperature |
120 ± 1 K |
| Ambient diffraction temperature |
120 ± 1 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1325 |
| Residual factor for significantly intense reflections |
0.0525 |
| Weighted residual factors for significantly intense reflections |
0.0976 |
| Weighted residual factors for all reflections included in the refinement |
0.1229 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.941 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012699.html