Information card for entry 2012759
| Common name |
pyrazolo[3,4-d]pyrimidine |
| Chemical name |
1-benzyl-5,7-dimethyl-4-dioxo-4,5,6,7-tetrahydropyrazolo[3,4-d]pyrimidine |
| Formula |
C14 H14 N4 O2 |
| Calculated formula |
C14 H14 N4 O2 |
| SMILES |
n1(ncc2c(=O)n(c(=O)n(c12)C)C)Cc1ccccc1 |
| Title of publication |
Isomeric pyrazolo[3,4-<i>d</i>]pyrimidine-based molecules: disappearance of dimerization due to interchanged substitutions |
| Authors of publication |
Avasthi, Kamlakar; Rawat, Diwan S.; Chandra, Tilak; Sharon, Ashoke; Maulik, Prakas R. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
6 |
| Pages of publication |
o311 - o313 |
| a |
12.468 ± 0.001 Å |
| b |
7.449 ± 0.001 Å |
| c |
15.076 ± 0.002 Å |
| α |
90° |
| β |
108.94 ± 0.01° |
| γ |
90° |
| Cell volume |
1324.4 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1301 |
| Residual factor for significantly intense reflections |
0.0593 |
| Weighted residual factors for significantly intense reflections |
0.1301 |
| Weighted residual factors for all reflections included in the refinement |
0.1588 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012759.html