Information card for entry 2012964
| Chemical name |
(-)-(1'S,4aS,7R,8aR)-4a-ethyl-1-(1'-phenylethyl)octahydroquinolinium-7-ol bromide |
| Formula |
C19 H30 Br N O |
| Calculated formula |
C19 H30 Br N O |
| SMILES |
[Br-].[NH+]1([C@@H](C)c2ccccc2)CCC[C@]2(CC[C@H](C[C@@H]12)O)CC |
| Title of publication |
(–)-(1'<i>S</i>,4a<i>S</i>,7<i>R</i>,8a<i>R</i>)-4a-Ethyl-7-hydroxy-1-(1'-phenylethyl)perhydroquinolinium bromide |
| Authors of publication |
Vázquez, Edna; Galindo, Alberto; Bernès, Sylvain; Gnecco, Dino |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
10 |
| Pages of publication |
o591 - o592 |
| a |
9.6977 ± 0.0008 Å |
| b |
9.2191 ± 0.0007 Å |
| c |
10.3008 ± 0.0008 Å |
| α |
90° |
| β |
92.624 ± 0.007° |
| γ |
90° |
| Cell volume |
919.97 ± 0.13 Å3 |
| Cell temperature |
300 ± 1 K |
| Ambient diffraction temperature |
300 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.044 |
| Residual factor for significantly intense reflections |
0.033 |
| Weighted residual factors for significantly intense reflections |
0.074 |
| Weighted residual factors for all reflections included in the refinement |
0.079 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012964.html