Information card for entry 2012973
| Common name |
6-acetonyldihydroavicine |
| Chemical name |
1-(5-methyl-5,6-dihydro[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-j] phenanthridin-6-yl)acetone |
| Formula |
C23 H19 N O5 |
| Calculated formula |
C23 H19 N O5 |
| SMILES |
c12ccc3cc4OCOc4cc3c1N(C(c1cc3OCOc3cc21)CC(=O)C)C |
| Title of publication |
6-Acetonyldihydroavicine |
| Authors of publication |
Morel, Ademir F.; Gonzaga, Wellington de A.; Burrow, Robert A.; Maichle-Mössmer, Cäcilia; Strähle, Johannes |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
10 |
| Pages of publication |
o606 - o607 |
| a |
8.2525 ± 0.0007 Å |
| b |
8.2653 ± 0.0006 Å |
| c |
13.9594 ± 0.0006 Å |
| α |
94.191 ± 0.006° |
| β |
93.879 ± 0.006° |
| γ |
105.293 ± 0.006° |
| Cell volume |
912.24 ± 0.11 Å3 |
| Cell temperature |
213 ± 2 K |
| Ambient diffraction temperature |
213 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0713 |
| Residual factor for significantly intense reflections |
0.0444 |
| Weighted residual factors for significantly intense reflections |
0.1113 |
| Weighted residual factors for all reflections included in the refinement |
0.1249 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012973.html