Information card for entry 2013251
| Chemical name |
1,4,7-Tris(2-cyanoethyl)-4,7-triaza-1-azoniacyclononane perchlorate |
| Formula |
C15 H25 Cl N6 O4 |
| Calculated formula |
C15 H25 Cl N6 O4 |
| SMILES |
C1CN(CC[NH+](CCN1CCC#N)CCC#N)CCC#N.Cl(=O)(=O)(=O)[O-] |
| Title of publication |
1,4,7-Tris(2-cyanoethyl)-4,7-triaza-1-azoniacyclononane perchlorate |
| Authors of publication |
Qi, Wen-Bin; Li, Yi-Zhi; Ni, Jun; Wang, Zhi-Lin |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
6 |
| Pages of publication |
o343 - o345 |
| a |
12.973 ± 0.007 Å |
| b |
9.708 ± 0.006 Å |
| c |
46.04 ± 0.03 Å |
| α |
90° |
| β |
92.544 ± 0.012° |
| γ |
90° |
| Cell volume |
5793 ± 6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0888 |
| Residual factor for significantly intense reflections |
0.0405 |
| Weighted residual factors for significantly intense reflections |
0.0873 |
| Weighted residual factors for all reflections included in the refinement |
0.0908 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013251.html