Information card for entry 2013488
| Chemical name |
(4-Dimethylamino-benzylidene)-(3,5-bis(2-Pyridyl)-1,2,4-triazol-4-yl)amine |
| Formula |
C21 H19 N7 |
| Calculated formula |
C21 H19 N7 |
| SMILES |
CN(c1ccc(cc1)/C=N/n1c(nnc1c1ccccn1)c1ccccn1)C |
| Title of publication |
4-[4-(Dimethylamino)benzylideneamino]-3,5-bis(2-pyridyl)-4<i>H</i>-1,2,4-triazole |
| Authors of publication |
Bruno, Giuseppe; Nicoló, Francesco; Puntoriero, Fausto; Giuffrida, Gaetano; Ricevuto, Vittorio; Rosace, Giuseppe |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
7 |
| Pages of publication |
o390 - o391 |
| a |
26.3 ± 0.004 Å |
| b |
9.469 ± 0.002 Å |
| c |
17.44 ± 0.002 Å |
| α |
90° |
| β |
117.69 ± 0.01° |
| γ |
90° |
| Cell volume |
3845.8 ± 1.1 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0612 |
| Residual factor for significantly intense reflections |
0.0323 |
| Weighted residual factors for significantly intense reflections |
0.0713 |
| Weighted residual factors for all reflections included in the refinement |
0.0761 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.793 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013488.html