Information card for entry 2013813
| Common name |
4-[(2,4-dinitrophenyl)hydrazonomethyl]benzene-1,3-diol N,N-dimethylformamide solvate |
| Chemical name |
2,4-dihydroxybenzaldehyde 2,4-dinitrophenylhydrazone N,N-dimethylformamide solvate |
| Formula |
C16 H17 N5 O7 |
| Calculated formula |
C16 H17 N5 O7 |
| SMILES |
Oc1cc(O)c(cc1)C=NNc1ccc(N(=O)=O)cc1N(=O)=O.O=CN(C)C |
| Title of publication |
2,4-Dinitrophenylhydrazones of 2,4-dihydroxybenzaldehyde, 2,4-dihydroxyacetophenone and 2,4-dihydroxybenzophenone |
| Authors of publication |
Baughman, Russell G.; Martin, Kenneth L.; Singh, Rajendra K.; Stoffer, James O. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
2 |
| Pages of publication |
o103 - o106 |
| a |
19.697 ± 0.004 Å |
| b |
7.152 ± 0.001 Å |
| c |
12.949 ± 0.003 Å |
| α |
90° |
| β |
100.34 ± 0.02° |
| γ |
90° |
| Cell volume |
1794.5 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.109 |
| Residual factor for significantly intense reflections |
0.051 |
| Weighted residual factors for significantly intense reflections |
0.113 |
| Weighted residual factors for all reflections included in the refinement |
0.137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013813.html