Information card for entry 2013890
| Formula |
C9 H17 N O2 |
| Calculated formula |
C9 H17 N O2 |
| SMILES |
CC(C[C@H]1C[C@@H](O)CC(=O)N1)C |
| Title of publication |
(6<i>S</i>)-6-Isobutylpiperidine-2,4-dione and (4<i>R</i>,6<i>S</i>)/(4<i>S</i>,6<i>S</i>)-4-hydroxy-6-isobutylpiperidin-2-one |
| Authors of publication |
Didierjean, Claude; Marin, Julien; Wenger, Emmanuel; Briand, Jean-Paul; Aubry, Andre; Guichard, Gilles |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
3 |
| Pages of publication |
o204 - o207 |
| a |
12.9121 ± 0.0006 Å |
| b |
5.3871 ± 0.0003 Å |
| c |
14.8945 ± 0.0007 Å |
| α |
90° |
| β |
109.692 ± 0.002° |
| γ |
90° |
| Cell volume |
975.45 ± 0.09 Å3 |
| Cell temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for significantly intense reflections |
0.0425 |
| Weighted residual factors for all reflections included in the refinement |
0.1139 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013890.html