Information card for entry 2014159
| Common name |
1,2-Bis(thiomethyl)-1,2-dicarba-closo-dodecaborane(12) |
| Chemical name |
1,2-Bis(thiomethyl)-1,2-dicarba-closo-dodecaborane(12) |
| Formula |
C4 H16 B10 S2 |
| Calculated formula |
C4 H16 B10 S2 |
| SMILES |
S([C]1234[C]567(SC)[BH]891[BH]1%102[BH]2%113[BH]345[BH]45%11[BH]%11%102[BH]291[BH]168[BH]734[BH]5%1121)C |
| Title of publication |
1,2-Bis(methylsulfanyl)-1,2-dicarba-<i>closo</i>-dodecaborane(12) |
| Authors of publication |
Laromaine, Anna; Viñas, Clara; Sillanpää, Reijo; Kivekäs, Raikko |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
7 |
| Pages of publication |
o524 - o526 |
| a |
7.1667 ± 0.0001 Å |
| b |
15.1733 ± 0.0002 Å |
| c |
11.8894 ± 0.0002 Å |
| α |
90° |
| β |
92.976 ± 0.001° |
| γ |
90° |
| Cell volume |
1291.14 ± 0.03 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0351 |
| Residual factor for significantly intense reflections |
0.0321 |
| Weighted residual factors for significantly intense reflections |
0.0842 |
| Weighted residual factors for all reflections included in the refinement |
0.0863 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mokα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014159.html