Information card for entry 2014553
| Chemical name |
5,5',6,6'-tetramethoxy-3,3',4,4'-tetrahydro-2H,2'H-3,3':4,4'- bi(furo[2,3-h]-1-benzopyran)-2,2'-dione |
| Formula |
C26 H20 O10 |
| Calculated formula |
C26 H20 O10 |
| SMILES |
o1c2c(OC)c(OC)c3[C@H]4[C@@H](C(=O)Oc3c2cc1)[C@H]1C(=O)Oc2c([C@@H]41)c(OC)c(OC)c1occc21 |
| Title of publication |
A pimpinellin monomer and dimer isolated from the roots of <i>Esenbeckia grandiflora</i> |
| Authors of publication |
Oliveira, P. E. S. de; Conserva, L.M.; De Simone, C.A.; Pereira, M.A.; Malta, V.R.S.; Imbroisi, D.O. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o900 - o902 |
| a |
9.205 ± 0.002 Å |
| b |
14.285 ± 0.004 Å |
| c |
17.978 ± 0.005 Å |
| α |
84 ± 0.01° |
| β |
83.28 ± 0.01° |
| γ |
77.66 ± 0.01° |
| Cell volume |
2285.8 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1934 |
| Residual factor for significantly intense reflections |
0.0764 |
| Weighted residual factors for significantly intense reflections |
0.1394 |
| Weighted residual factors for all reflections included in the refinement |
0.1825 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014553.html