Information card for entry 2014631
| Chemical name |
Ammonium 2,4,6-trimethylbenzenesulfonate |
| Formula |
C9 H15 N O3 S |
| Calculated formula |
C9 H15 N O3 S |
| SMILES |
S(=O)(=O)([O-])c1c(cc(cc1C)C)C.[NH4+] |
| Title of publication |
Polymorphism in ammonium 2,4,6-trimethylbenzenesulfonate |
| Authors of publication |
Aucott, Stephen M.; Dale, Sophie H.; Elsegood, Mark R. J.; Holmes, Kathryn E.; Gilby, Liam M.; Kelly, Paul F. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
3 |
| Pages of publication |
o134 - o137 |
| a |
8.4792 ± 0.0013 Å |
| b |
9.6152 ± 0.0015 Å |
| c |
26.864 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2190.2 ± 0.6 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0979 |
| Residual factor for significantly intense reflections |
0.0662 |
| Weighted residual factors for significantly intense reflections |
0.1531 |
| Weighted residual factors for all reflections included in the refinement |
0.1988 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.15 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014631.html