Information card for entry 2014731
| Chemical name |
5-(1-hydroxyethylidene)-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Formula |
C8 H10 N2 O4 |
| Calculated formula |
C8 H10 N2 O4 |
| SMILES |
O=C1N(C)C(=O)C(=C(/O)C)/C(=O)N1C |
| Title of publication |
5-(1-Hydroxyethylidene)-1,3-dimethylpyrimidine-2,4,6(1<i>H</i>,3<i>H</i>,5<i>H</i>)-trione and four amino derivatives |
| Authors of publication |
da Silva, Emerson T.; Ribiero, Rodrigo S.; Lima, Edson L. S.; Wardell, James L.; Skakle, Janet M. S.; Low, John N.; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
1 |
| Pages of publication |
o15 - o20 |
| a |
8.6066 ± 0.0005 Å |
| b |
9.1751 ± 0.0005 Å |
| c |
11.9799 ± 0.0007 Å |
| α |
90° |
| β |
109.321 ± 0.002° |
| γ |
90° |
| Cell volume |
892.73 ± 0.09 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1017 |
| Residual factor for significantly intense reflections |
0.0635 |
| Weighted residual factors for significantly intense reflections |
0.1799 |
| Weighted residual factors for all reflections included in the refinement |
0.207 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014731.html