Information card for entry 2014866
| Chemical name |
(1S*,2S*,4S*,5S*)Cyclohexane-1,2,4,5-tetrol monohydrate |
| Formula |
C6 H14 O5 |
| Calculated formula |
C6 H14 O5 |
| SMILES |
O[C@H]1C[C@H](O)[C@H](C[C@@H]1O)O.O |
| Title of publication |
(1<i>S</i>*,2<i>S</i>*,4<i>S</i>*,5<i>S</i>*)-Cyclohexane-1,2,4,5-tetrol monohydrate |
| Authors of publication |
Goverdhan Mehta; Saikat Sen; Siddharth Dey |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o358 - o360 |
| a |
10.675 ± 0.002 Å |
| b |
7.3502 ± 0.0015 Å |
| c |
5.1968 ± 0.0011 Å |
| α |
90° |
| β |
103.877 ± 0.003° |
| γ |
90° |
| Cell volume |
395.86 ± 0.14 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0333 |
| Residual factor for significantly intense reflections |
0.0331 |
| Weighted residual factors for significantly intense reflections |
0.082 |
| Weighted residual factors for all reflections included in the refinement |
0.0822 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.168 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014866.html