Information card for entry 2015140
| Chemical name |
2,3-dibromo-1,3-diphenylpropan-1-one |
| Formula |
C15 H12 Br2 O |
| Calculated formula |
C15 H12 Br2 O |
| SMILES |
c1ccccc1[C@H]([C@H](C(=O)c1ccccc1)Br)Br.c1ccccc1[C@@H]([C@@H](C(=O)c1ccccc1)Br)Br |
| Title of publication |
Do C—H···O and C—H···π interactions help to stabilize a non-centrosymmetric structure for racemic 2,3-dibromo-1,3-diphenylpropan-1-one? |
| Authors of publication |
Harrison, William T. A.; Yathirajan, H. S.; Sarojini, B. K.; Narayana, B.; Anilkumar, H. G. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
12 |
| Pages of publication |
o728 - o730 |
| a |
20.6762 ± 0.0007 Å |
| b |
7.2443 ± 0.0002 Å |
| c |
10.3501 ± 0.0003 Å |
| α |
90° |
| β |
116.575 ± 0.002° |
| γ |
90° |
| Cell volume |
1386.5 ± 0.08 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0291 |
| Residual factor for significantly intense reflections |
0.0264 |
| Weighted residual factors for significantly intense reflections |
0.057 |
| Weighted residual factors for all reflections included in the refinement |
0.0582 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015140.html