Information card for entry 2015263
| Chemical name |
(-)-(5S,8S,9R,10S,13R,14R)-15-Acetoxy-15,16-dideoxy-16,17-epoxyspongian-16-one |
| Formula |
C22 H34 O4 |
| Calculated formula |
C22 H34 O4 |
| SMILES |
C1CCC([C@@H]2CC[C@]34[C@@H]([C@@]12C)CC[C@H]([C@H]3COC(=O)C)C(=O)OC4)(C)C |
| Title of publication |
(–)-(5<i>S</i>,8<i>S</i>,9<i>R</i>,10<i>S</i>,13<i>R</i>,14<i>R</i>)-15,16-Dideoxy-16,17-epoxy-16-oxospongian-15-yl acetate |
| Authors of publication |
Blake, Alexander J.; González, Miguel A.; Gil-Gimeno, Maria J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
4 |
| Pages of publication |
o208 - o210 |
| a |
13.377 ± 0.002 Å |
| b |
6.0824 ± 0.0008 Å |
| c |
23.834 ± 0.003 Å |
| α |
90° |
| β |
94.235 ± 0.002° |
| γ |
90° |
| Cell volume |
1933.9 ± 0.5 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0516 |
| Residual factor for significantly intense reflections |
0.0487 |
| Weighted residual factors for significantly intense reflections |
0.13 |
| Weighted residual factors for all reflections included in the refinement |
0.133 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.92 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015263.html