Information card for entry 2015358
| Common name |
(1-thyminyl)acetamide |
| Chemical name |
(1-thyminyl)acetamide(5-methyl-2,4-dioxo-1,2,3,4- tetrahydropyrimidin-1-yl)acetamide |
| Formula |
C7 H9 N3 O3 |
| Calculated formula |
C7 H9 N3 O3 |
| SMILES |
N1(CC(=O)N)C(=O)NC(=O)C(C)=C1 |
| Title of publication |
Molecular packing in (5-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)acetamide |
| Authors of publication |
Borowiak, Teresa; Dutkiewicz, Grzegorz; Spychała, Jarosław |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
6 |
| Pages of publication |
o344 - o345 |
| a |
8.0388 ± 0.0001 Å |
| b |
6.1476 ± 0.0001 Å |
| c |
15.839 ± 0.0001 Å |
| α |
90° |
| β |
92.923 ± 0.001° |
| γ |
90° |
| Cell volume |
781.734 ± 0.017 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0367 |
| Residual factor for significantly intense reflections |
0.0363 |
| Weighted residual factors for significantly intense reflections |
0.0939 |
| Weighted residual factors for all reflections included in the refinement |
0.0942 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015358.html