Information card for entry 2015444
| Chemical name |
(1SR,2SR,3SR,4RS,5RS,6RS,7SR,8RS)-7,8-Dichlorobicyclo[4.2.0]octa-2,3,4,5-tetrayl tetraacetate |
| Formula |
C16 H20 Cl2 O8 |
| Calculated formula |
C16 H20 Cl2 O8 |
| SMILES |
[C@@H]1([C@H]([C@H]2[C@@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)[C@@H]([C@@H]2Cl)Cl)OC(=O)C)OC(=O)C |
| Title of publication |
(1<i>SR</i>,2<i>SR</i>,3<i>SR</i>,4<i>RS</i>,5<i>RS</i>,6<i>RS</i>,7<i>SR</i>,8<i>RS</i>)-7,8-Dichlorobicyclo[4.2.0]octa-2,3,4,5-tetrayl tetraacetate |
| Authors of publication |
Şahin, Ertan; Kelebekli, Latif; Kara, Yunus; Balci, Metin |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
7 |
| Pages of publication |
o432 - o434 |
| a |
8.9489 ± 0.0005 Å |
| b |
11.023 ± 0.0008 Å |
| c |
11.2885 ± 0.0007 Å |
| α |
111.427 ± 0.002° |
| β |
98.281 ± 0.001° |
| γ |
108.834 ± 0.001° |
| Cell volume |
936.71 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.076 |
| Weighted residual factors for all reflections included in the refinement |
0.1896 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.321 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015444.html