Information card for entry 2015641
| Chemical name |
trans-Bis[1-benzyl-3-(2,3,4,5,6-pentafluorobenzyl)benzimidazol-2- ylidene]dibromopalladium(II) |
| Formula |
C42 H26 Br2 F10 N4 Pd |
| Calculated formula |
C42 H26 Br2 F10 N4 Pd |
| SMILES |
C1(N(c2ccccc2N1Cc1ccccc1)Cc1c(F)c(F)c(F)c(F)c1F)=[Pd](Br)(=C1N(c2ccccc2N1Cc1ccccc1)Cc1c(F)c(F)c(F)c(F)c1F)Br |
| Title of publication |
<i>trans</i>-Bis[1-benzyl-3-(2,3,4,5,6-pentafluorobenzyl)benzimidazol-2-ylidene]dibromopalladium(II) |
| Authors of publication |
Aytaç Gürhan Gökçe; Gülcemal, Süleyman; Aygün, Muhittin; Çetinkaya, Bekir; Büyükgüngör, Orhan |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
11 |
| Pages of publication |
m535 - m537 |
| a |
11.6122 ± 0.0008 Å |
| b |
12.1401 ± 0.0009 Å |
| c |
13.659 ± 0.0011 Å |
| α |
92.589 ± 0.006° |
| β |
95.61 ± 0.006° |
| γ |
92.52 ± 0.006° |
| Cell volume |
1912.1 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1331 |
| Residual factor for significantly intense reflections |
0.0591 |
| Weighted residual factors for significantly intense reflections |
0.0979 |
| Weighted residual factors for all reflections included in the refinement |
0.1192 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.95 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015641.html
