Information card for entry 2016024
| Chemical name |
(<i>E</i>,<i>E</i>)-1,4-bis[2-(2,2':5',2''-terthiophen-3'-yl)ethenyl]-2,5- dimethoxybenzene |
| Formula |
C36 H26 O2 S6 |
| Calculated formula |
C36 H26 O2 S6 |
| SMILES |
COc1cc(/C=C/c2cc(sc2c2cccs2)c2cccs2)c(cc1/C=C/c1cc(sc1c1cccs1)c1cccs1)OC |
| Title of publication |
Flip-type disorder in 3-substituted 2,2':5',2''-terthiophenes |
| Authors of publication |
Wagner, Paweł; Officer, David L.; Kubicki, Maciej |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
o400 - o404 |
| a |
9.341 ± 0.001 Å |
| b |
36.688 ± 0.003 Å |
| c |
10.097 ± 0.002 Å |
| α |
90° |
| β |
115.36 ± 0.01° |
| γ |
90° |
| Cell volume |
3126.8 ± 0.8 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1433 |
| Residual factor for significantly intense reflections |
0.071 |
| Weighted residual factors for significantly intense reflections |
0.1227 |
| Weighted residual factors for all reflections included in the refinement |
0.1394 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.089 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016024.html