Information card for entry 2016154
| Chemical name |
4,4',6,6'-tetrachloro-2,2'-(piperazin-1,4-diyldimethylene)diphenol |
| Formula |
C18 H18 Cl4 N2 O2 |
| Calculated formula |
C18 H18 Cl4 N2 O2 |
| SMILES |
Clc1cc(CN2CCN(CC2)Cc2cc(Cl)cc(c2O)Cl)c(c(c1)Cl)O |
| Title of publication |
Monoclinic and orthorhombic polymorphs of 4,4',6,6'-tetrachloro-2,2'-(piperazine-1,4-diyldimethylene)diphenol |
| Authors of publication |
Kubono, Koji; Yokoi, Kunihiko |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
9 |
| Pages of publication |
o535 - o537 |
| a |
7.4861 ± 0.0013 Å |
| b |
17.2008 ± 0.0013 Å |
| c |
8.0283 ± 0.0019 Å |
| α |
90° |
| β |
111.972 ± 0.013° |
| γ |
90° |
| Cell volume |
958.7 ± 0.3 Å3 |
| Cell temperature |
298 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0402 |
| Weighted residual factors for all reflections included in the refinement |
0.1248 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.009 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016154.html