Information card for entry 2016217
| Chemical name |
8-<i>tert</i>-Butyl-7-(4-chlorophenyl)-10-phenyl-5,6-dihydro-10<i>H</i>- benzo[<i>h</i>]pyrazolo[3,4-<i>b</i>]quinoline |
| Formula |
C30 H26 Cl N3 |
| Calculated formula |
C30 H26 Cl N3 |
| SMILES |
c1c2c3c(CCc2ccc1)c(c1ccc(Cl)cc1)c1c(C(C)(C)C)nn(c2ccccc2)c1n3 |
| Title of publication |
8-<i>tert</i>-Butyl-7-(4-chlorophenyl)-10-phenyl-5,6-dihydro-10<i>H</i>-benzo[<i>h</i>]pyrazolo[3,4-<i>b</i>]quinoline |
| Authors of publication |
Portilla, Jaime; Quiroga, Jairo; Cobo, Justo; Low, John N.; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
10 |
| Pages of publication |
o582 - o584 |
| a |
13.117 ± 0.0018 Å |
| b |
15.948 ± 0.003 Å |
| c |
17.717 ± 0.002 Å |
| α |
93.75 ± 0.011° |
| β |
91.803 ± 0.009° |
| γ |
101.155 ± 0.013° |
| Cell volume |
3624.7 ± 1 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1669 |
| Residual factor for significantly intense reflections |
0.0655 |
| Weighted residual factors for significantly intense reflections |
0.155 |
| Weighted residual factors for all reflections included in the refinement |
0.2106 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016217.html