Information card for entry 2016424
| Chemical name |
6-ethyl-2a,7b-diphenyl-2,2a,3,4,6,7-hexahydro-1H,5H-2,3,4a,6,7a- pentaazacyclopenta[cd]azulene-1,4-dione |
| Formula |
C20 H21 N5 O2 |
| Calculated formula |
C20 H21 N5 O2 |
| SMILES |
C12(c3ccccc3)C3(c4ccccc4)N(C(=O)N1)CN(CN3C(=O)N2)CC |
| Title of publication |
Two-dimensional hydrogen-bonded networks in two novel glycoluril derivatives |
| Authors of publication |
Li-Ping Cao; Xiang-Gao Meng; Meng Gao; Neng-Fang She; An-Xin Wu |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o69 - o72 |
| a |
8.0724 ± 0.0005 Å |
| b |
11.6462 ± 0.0007 Å |
| c |
19.2338 ± 0.0012 Å |
| α |
90° |
| β |
100.462 ± 0.001° |
| γ |
90° |
| Cell volume |
1778.16 ± 0.19 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1032 |
| Residual factor for significantly intense reflections |
0.0632 |
| Weighted residual factors for significantly intense reflections |
0.1435 |
| Weighted residual factors for all reflections included in the refinement |
0.1587 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mokα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016424.html