Information card for entry 2016502
| Common name |
15-<i>cis</i>-β,β-carotene |
| Chemical name |
15-<i>cis</i>-β,β-carotene |
| Formula |
C40 H56 |
| Calculated formula |
C40 H56 |
| SMILES |
CC(=C\C=C/C=C(/C=C/C=C(/C=C/C1=C(C)CCCC1(C)C)C)C)/C=C/C=C(/C=C/C1=C(C)CCCC1(C)C)C |
| Title of publication |
13-<i>cis</i>-β,β-Carotene and 15-<i>cis</i>-β,β-carotene |
| Authors of publication |
Bartalucci, Giuditta; Delroy, Charles; Fisher, Stuart; Helliwell, Madeleine; Liaaen-Jensen, Synnøve |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
o128 - o131 |
| a |
17.6168 ± 0.0013 Å |
| b |
11.5544 ± 0.0009 Å |
| c |
17.4124 ± 0.0013 Å |
| α |
90° |
| β |
108.084 ± 0.001° |
| γ |
90° |
| Cell volume |
3369.2 ± 0.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
2 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0452 |
| Residual factor for significantly intense reflections |
0.0394 |
| Weighted residual factors for significantly intense reflections |
0.1078 |
| Weighted residual factors for all reflections included in the refinement |
0.1113 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016502.html