Information card for entry 2016762
| Chemical name |
(2<i>R</i>,4<i>R</i>)-7-fluoro-2-endo-[(<i>E</i>)-styryl]-2,3,4,5-tetrahydro- 1,4-epoxy-1H-1-benzazepine |
| Formula |
C18 H16 F N O |
| Calculated formula |
C18 H16 F N O |
| SMILES |
Fc1cc2C[C@H]3ON([C@H](C3)/C=C/c3ccccc3)c2cc1 |
| Title of publication |
Three styryl-substituted tetrahydro-1,4-epoxy-1-benzazepines: configurations, conformations and hydrogen-bonded chains |
| Authors of publication |
Acosta, Lina M.; Bahsas, Ali; Palma, Alirio; Cobo, Justo; Low, John N.; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
o514 - o518 |
| a |
5.4172 ± 0.0002 Å |
| b |
8.0164 ± 0.0006 Å |
| c |
16.231 ± 0.0011 Å |
| α |
90° |
| β |
96.745 ± 0.004° |
| γ |
90° |
| Cell volume |
699.98 ± 0.08 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0448 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0776 |
| Weighted residual factors for all reflections included in the refinement |
0.0833 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.166 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016762.html