Information card for entry 2016879
| Chemical name |
2-Amino-4-methoxy-6-(4-methoxyphenyl)-11<i>H</i>-pyrimido[4,5- <i>b</i>][1,4]benzodiazepine |
| Formula |
C19 H17 N5 O2 |
| Calculated formula |
C19 H17 N5 O2 |
| SMILES |
O(c1nc(nc2Nc3c(C(=Nc12)c1ccc(OC)cc1)cccc3)N)C |
| Title of publication |
Four 2-amino-6-aryl-4-methoxy-11<i>H</i>-pyrimido[4,5-<i>b</i>][1,4]benzodiazepines: similar molecular structures but different crystal structures |
| Authors of publication |
Rodríguez, Ricaurte; Cobo, Justo; Nogueras, Manuel; Low, John N.; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
o643 - o648 |
| a |
7.6718 ± 0.0018 Å |
| b |
13.2928 ± 0.0015 Å |
| c |
15.969 ± 0.002 Å |
| α |
90° |
| β |
95.343 ± 0.012° |
| γ |
90° |
| Cell volume |
1621.4 ± 0.5 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.2114 |
| Residual factor for significantly intense reflections |
0.0693 |
| Weighted residual factors for significantly intense reflections |
0.1477 |
| Weighted residual factors for all reflections included in the refinement |
0.1892 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.944 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016879.html