Information card for entry 2016968
| Common name |
2-amino-4,6-dimethoxypyrimidinium picrate |
| Chemical name |
2-amino-4,6-dimethoxypyrimidinium 2,4,6-trinitrophenolate |
| Formula |
C12 H12 N6 O9 |
| Calculated formula |
C12 H12 N6 O9 |
| SMILES |
O(c1nc([nH+]c(OC)c1)N)C.[O-]c1c(cc(N(=O)=O)cc1N(=O)=O)N(=O)=O |
| Title of publication |
Hydrogen-bonded supramolecular motifs in 2-amino-4,6-dimethoxypyrimidinium picrate and pyrimethaminium picrate dimethyl sulfoxide solvate |
| Authors of publication |
Thanigaimani, Kaliyaperumal; Subashini, Annamalai; Muthiah, Packianathan Thomas; Lynch, Daniel E.; Butcher, Ray J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
o42 - o45 |
| a |
8.8796 ± 0.0002 Å |
| b |
13.2847 ± 0.0003 Å |
| c |
14.1395 ± 0.0003 Å |
| α |
99.82 ± 0.001° |
| β |
100.701 ± 0.001° |
| γ |
105.095 ± 0.001° |
| Cell volume |
1539.68 ± 0.06 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0672 |
| Residual factor for significantly intense reflections |
0.0522 |
| Weighted residual factors for significantly intense reflections |
0.1118 |
| Weighted residual factors for all reflections included in the refinement |
0.1214 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016968.html