Information card for entry 2017254
| Common name |
II |
| Chemical name |
2,2,3,3,4,4-hexafluoropentane-1,5-diol |
| Formula |
C5 H6 F6 O2 |
| Calculated formula |
C5 H6 F6 O2 |
| SMILES |
OCC(C(C(CO)(F)F)(F)F)(F)F |
| Title of publication |
Enantiotropic phase transition and twinning in 2,2,3,3,4,4-hexafluoropentane-1,5-diol |
| Authors of publication |
Ha, Jeong-Myeong; Young, Victor |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o388 - o395 |
| a |
4.8641 ± 0.0012 Å |
| b |
5.738 ± 0.0014 Å |
| c |
13.325 ± 0.003 Å |
| α |
82.814 ± 0.003° |
| β |
87.274 ± 0.003° |
| γ |
86.435 ± 0.004° |
| Cell volume |
367.97 ± 0.15 Å3 |
| Cell temperature |
173 ± 0.1 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0739 |
| Residual factor for significantly intense reflections |
0.0537 |
| Weighted residual factors for significantly intense reflections |
0.126 |
| Weighted residual factors for all reflections included in the refinement |
0.138 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017254.html