Information card for entry 2017279
| Chemical name |
(2<i>SR</i>,4<i>RS</i>)-2-<i>exo</i>-(2-Chloro-6-fluorophenyl)-2,3,4,5- tetrahydro-1<i>H</i>-1,4-epoxy-1-benzazepine |
| Formula |
C16 H13 Cl F N O |
| Calculated formula |
C16 H13 Cl F N O |
| SMILES |
N12[C@@H](C[C@@H](Cc3ccccc13)O2)c1c(Cl)cccc1F.N12[C@H](C[C@H](Cc3ccccc13)O2)c1c(Cl)cccc1F |
| Title of publication |
Four differently substituted 2-aryl-2,3,4,5-tetrahydro-1<i>H</i>-1,4-epoxy-1-benzazepines: hydrogen-bonded structures in one, two and three dimensions |
| Authors of publication |
Gómez, Sandra L.; Sanabria, Carlos M.; Palma, Alirio; Bahsas, Ali; Cobo, Justo; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o465 - o469 |
| a |
9.0768 ± 0.0013 Å |
| b |
10.9461 ± 0.0009 Å |
| c |
12.9971 ± 0.0018 Å |
| α |
90° |
| β |
99.768 ± 0.009° |
| γ |
90° |
| Cell volume |
1272.6 ± 0.3 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0767 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.1168 |
| Weighted residual factors for all reflections included in the refinement |
0.1368 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017279.html