Information card for entry 2017282
| Formula |
C17 H16 Cl N O |
| Calculated formula |
C17 H16 Cl N O |
| SMILES |
Cc1ccc2c(c1)C[C@H]1ON2[C@@H](C1)c1ccccc1Cl.Cc1ccc2c(c1)C[C@@H]1ON2[C@H](C1)c1ccccc1Cl |
| Title of publication |
Four differently substituted 2-aryl-2,3,4,5-tetrahydro-1<i>H</i>-1,4-epoxy-1-benzazepines: hydrogen-bonded structures in one, two and three dimensions |
| Authors of publication |
Gómez, Sandra L.; Sanabria, Carlos M.; Palma, Alirio; Bahsas, Ali; Cobo, Justo; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o465 - o469 |
| a |
8.715 ± 0.0009 Å |
| b |
10.406 ± 0.002 Å |
| c |
15.312 ± 0.004 Å |
| α |
99.547 ± 0.019° |
| β |
90.621 ± 0.014° |
| γ |
96.514 ± 0.013° |
| Cell volume |
1359.9 ± 0.5 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.164 |
| Residual factor for significantly intense reflections |
0.1126 |
| Weighted residual factors for significantly intense reflections |
0.2829 |
| Weighted residual factors for all reflections included in the refinement |
0.3083 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.152 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017282.html