Information card for entry 2017589
| Chemical name |
Imidazolium hydrogen 2,3,5,6-tetrafluoroterephthalate |
| Formula |
C11 H6 F4 N2 O4 |
| Calculated formula |
C11 H6 F4 N2 O4 |
| SMILES |
Fc1c(c(F)c(F)c(c1F)C(=O)O)C(=O)[O-].[nH]1c[nH+]cc1 |
| Title of publication |
Three-dimensional supramolecular architecture in imidazolium hydrogen 2,3,5,6-tetrafluoroterephthalate |
| Authors of publication |
Yu, Li-Li; Cheng, Mei-Ling; Liu, Qi; Zhang, Zhi-Hui; Chen, Qun |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o179 - o181 |
| a |
9.716 ± 0.003 Å |
| b |
7.229 ± 0.003 Å |
| c |
17.406 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1222.5 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0296 |
| Residual factor for significantly intense reflections |
0.0265 |
| Weighted residual factors for significantly intense reflections |
0.0711 |
| Weighted residual factors for all reflections included in the refinement |
0.0735 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017589.html