Information card for entry 2017697
| Common name |
POPOP . 2dioxane |
| Chemical name |
5,5'-diphenyl-2,2'-(<i>p</i>-phenylene)di-1,3-oxazole dioxane disolvate |
| Formula |
C32 H32 N2 O6 |
| Calculated formula |
C32 H32 N2 O6 |
| SMILES |
O1CCOCC1.O1CCOCC1.c1ccc(cc1)c1cnc(o1)c1ccc(cc1)c1ncc(o1)c1ccccc1 |
| Title of publication |
Influence of 1,4-dioxane solvent inclusion on the crystal structure of 5,5'-diphenyl-2,2'-(<i>p</i>-phenylene)di-1,3-oxazole (POPOP) |
| Authors of publication |
Schindler, Diana; Felsmann, Marika; Weber, Edwin |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o361 - o363 |
| a |
12.2424 ± 0.0006 Å |
| b |
5.9115 ± 0.0003 Å |
| c |
18.5046 ± 0.0009 Å |
| α |
90° |
| β |
97.977 ± 0.003° |
| γ |
90° |
| Cell volume |
1326.24 ± 0.11 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0447 |
| Residual factor for significantly intense reflections |
0.0302 |
| Weighted residual factors for significantly intense reflections |
0.069 |
| Weighted residual factors for all reflections included in the refinement |
0.075 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017697.html