Information card for entry 2017726
| Common name |
di(4-ethylamino-3-nitrobenzene)sulfone |
| Chemical name |
bis(4-ethylamino-3-nitrophenyl) sulfone |
| Formula |
C16 H18 N4 O6 S |
| Calculated formula |
C16 H18 N4 O6 S |
| SMILES |
S(=O)(=O)(c1cc(N(=O)=O)c(NCC)cc1)c1cc(N(=O)=O)c(NCC)cc1 |
| Title of publication |
<i>N</i>,<i>N</i>'-Diethyl-4-nitrobenzene-1,3-diamine, 2,6-bis(ethylamino)-3-nitrobenzonitrile and bis(4-ethylamino-3-nitrophenyl) sulfone |
| Authors of publication |
Payne, Thomas J.; Thurman, Chad R.; Yu, Hao; Sun, Qian; Mohanty, Dillip K.; Squattrito, Philip J.; Giolando, Mark-Robin; Brue, Christopher R.; Kirschbaum, Kristin |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o369 - o373 |
| a |
15.514 ± 0.005 Å |
| b |
8.573 ± 0.004 Å |
| c |
15.012 ± 0.005 Å |
| α |
90° |
| β |
115.647 ± 0.012° |
| γ |
90° |
| Cell volume |
1799.9 ± 1.2 Å3 |
| Cell temperature |
210 ± 1 K |
| Ambient diffraction temperature |
210 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0417 |
| Residual factor for significantly intense reflections |
0.0339 |
| Weighted residual factors for significantly intense reflections |
0.0903 |
| Weighted residual factors for all reflections included in the refinement |
0.0951 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017726.html