Information card for entry 2017790
| Chemical name |
7-Amino-2-methylsulfanyl-1,2,4-triazolo[1,5-<i>a</i>]pyrimidine-6-carboxylic acid dimethylformamide monosolvate |
| Formula |
C10 H14 N6 O3 S |
| Calculated formula |
C10 H14 N6 O3 S |
| SMILES |
S(c1nn2c(n1)ncc(c2N)C(=O)O)C.O=CN(C)C |
| Title of publication |
7-Amino-2-methylsulfanyl-1,2,4-triazolo[1,5-<i>a</i>]pyrimidine-6-carboxylic acid as the dimethylformamide and water monosolvates at 293K |
| Authors of publication |
Canfora, Loredana; Pillet, Sebastien; Espinosa, Enrique; Ruisi, Giuseppe |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o503 - o507 |
| a |
12.1365 ± 0.0006 Å |
| b |
11.218 ± 0.0007 Å |
| c |
10.3559 ± 0.0005 Å |
| α |
90° |
| β |
108.57 ± 0.003° |
| γ |
90° |
| Cell volume |
1336.52 ± 0.13 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0737 |
| Residual factor for significantly intense reflections |
0.0539 |
| Weighted residual factors for significantly intense reflections |
0.1084 |
| Weighted residual factors for all reflections included in the refinement |
0.1196 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.161 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017790.html