Information card for entry 2017931
| Chemical name |
3-[(<i>Z</i>)-1,3-dimethyl-5,6,7,8-tetrahydro-4<i>H</i>-\ cyclohepta[<i>c</i>]furan-4-ylidene]-4-isopropylidenetetrahydrofuran-2,5-dione |
| Formula |
C18 H20 O4 |
| Calculated formula |
C18 H20 O4 |
| SMILES |
O1C(=O)C(C(C1=O)=C(C)C)=C1c2c(oc(c2CCCC1)C)C |
| Title of publication |
Rotationally-hindered furyl fulgides |
| Authors of publication |
Strübe, Frank; Mattay, Jochen; Neumann, Beate; Stammler, Hans-Georg |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o33 - o36 |
| a |
8.7024 ± 0.0002 Å |
| b |
12.8964 ± 0.0004 Å |
| c |
26.9492 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3024.5 ± 0.14 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0542 |
| Residual factor for significantly intense reflections |
0.0377 |
| Weighted residual factors for significantly intense reflections |
0.0885 |
| Weighted residual factors for all reflections included in the refinement |
0.0965 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017931.html